C30H43ClN2O3S — CID 127033958
ethyl (1S,4S,5R,9S,10S,13S,14R,15S)-14-[(3-chlorophenyl)carbamothioylamino]-15-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 127033958) has the molecular formula C30H43ClN2O3S and a molecular weight of 547.21 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,14R,15S)-14-[(3-chlorophenyl)carbamothioylamino]-15-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15S)-14-[(3-chlorophenyl)carbamothioylamino]-15-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 127033958 |
| Molecular Formula | C30H43ClN2O3S |
| Molecular Weight | 547.21 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15S)-14-[(3-chlorophenyl)carbamothioylamino]-15-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@H](CO)[C@H]4NC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H43ClN2O3S/c1-5-36-25(35)29(4)13-7-12-28(3)22(29)11-15-30-18-27(2,14-10-23(28)30)24(21(30)17-34)33-26(37)32-20-9-6-8-19(31)16-20/h6,8-9,16,21-24,34H,5,7,10-15,17-18H2,1-4H3,(H2,32,33,37)/t21-,22+,23+,24-,27+,28-,29-,30-/m1/s1 |
| InChIKey | ZXUCLNLLJTUVGE-SGAOCFLWSA-N |
| XLogP | 6.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.21 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|