C17H23ClN2OS — CID 132608373
1-(3-chlorophenyl)-3-[(1R,2R,3R,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiourea (PubChem CID 132608373) has the molecular formula C17H23ClN2OS and a molecular weight of 338.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1R,2R,3R,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1R,2R,3R,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 132608373 |
| Molecular Formula | C17H23ClN2OS |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1R,2R,3R,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]thiourea |
| SMILES | CC1(C)[C@H]2C[C@@H](CO)[C@H](NC(=S)Nc3cccc(Cl)c3)[C@@H]1C2 |
| InChI | InChI=1S/C17H23ClN2OS/c1-17(2)11-6-10(9-21)15(14(17)7-11)20-16(22)19-13-5-3-4-12(18)8-13/h3-5,8,10-11,14-15,21H,6-7,9H2,1-2H3,(H2,19,20,22)/t10-,11-,14-,15-/m0/s1 |
| InChIKey | ULAUJHUIJSIVMU-GVARAGBVSA-N |
| XLogP | 3.67 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|