C20H28N2O3S — CID 87318100
ethyl (1R,2R,3S)-2-[(3-methoxyphenyl)carbamothioylamino]-6,6-dimethylbicyclo[3.1.1]heptane-3-carboxylate (PubChem CID 87318100) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is ethyl (1R,2R,3S)-2-[(3-methoxyphenyl)carbamothioylamino]-6,6-dimethylbicyclo[3.1.1]heptane-3-carboxylate.
| Compound Name | ethyl (1R,2R,3S)-2-[(3-methoxyphenyl)carbamothioylamino]-6,6-dimethylbicyclo[3.1.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 87318100 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl (1R,2R,3S)-2-[(3-methoxyphenyl)carbamothioylamino]-6,6-dimethylbicyclo[3.1.1]heptane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC2C[C@@H]([C@H]1NC(=S)Nc1cccc(OC)c1)C2(C)C |
| InChI | InChI=1S/C20H28N2O3S/c1-5-25-18(23)15-9-12-10-16(20(12,2)3)17(15)22-19(26)21-13-7-6-8-14(11-13)24-4/h6-8,11-12,15-17H,5,9-10H2,1-4H3,(H2,21,22,26)/t12?,15-,16-,17-/m0/s1 |
| InChIKey | WQYGOCGZCANGSV-CPWCDSSXSA-N |
| XLogP | 3.60 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|