C27H44N2O4 — CID 70688849
ethyl (1S,4S,5R,9S,10S,13S,14S,15R)-15-hydroxy-5,9,13-trimethyl-14-[[(2S)-pyrrolidine-2-carbonyl]amino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 70688849) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,14S,15R)-15-hydroxy-5,9,13-trimethyl-14-[[(2S)-pyrrolidine-2-carbonyl]amino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,14S,15R)-15-hydroxy-5,9,13-trimethyl-14-[[(2S)-pyrrolidine-2-carbonyl]amino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 70688849 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,14S,15R)-15-hydroxy-5,9,13-trimethyl-14-[[(2S)-pyrrolidine-2-carbonyl]amino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@@H](O)[C@H]4NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C27H44N2O4/c1-5-33-23(32)26(4)12-7-11-25(3)18(26)10-14-27-16-24(2,13-9-19(25)27)20(21(27)30)29-22(31)17-8-6-15-28-17/h17-21,28,30H,5-16H2,1-4H3,(H,29,31)/t17-,18-,19-,20+,21-,24-,25+,26+,27-/m0/s1 |
| InChIKey | ALXOTQISUCTGNP-PPGMHWBLSA-N |
| XLogP | 3.56 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |