C29H49N3O2S — CID 134847356
ethyl (1R,5R,9S,13S,14R)-14-[(2-aminocyclohexyl)carbamothioylamino]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134847356) has the molecular formula C29H49N3O2S and a molecular weight of 503.80 g/mol. Its IUPAC name is ethyl (1R,5R,9S,13S,14R)-14-[(2-aminocyclohexyl)carbamothioylamino]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1R,5R,9S,13S,14R)-14-[(2-aminocyclohexyl)carbamothioylamino]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134847356 |
| Molecular Formula | C29H49N3O2S |
| Molecular Weight | 503.80 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | ethyl (1R,5R,9S,13S,14R)-14-[(2-aminocyclohexyl)carbamothioylamino]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)C3CC[C@@]4(C)C[C@]3(CCC21)C[C@H]4NC(=S)NC1CCCCC1N |
| InChI | InChI=1S/C29H49N3O2S/c1-5-34-24(33)28(4)14-8-13-27(3)21(28)12-16-29-17-23(26(2,18-29)15-11-22(27)29)32-25(35)31-20-10-7-6-9-19(20)30/h19-23H,5-18,30H2,1-4H3,(H2,31,32,35)/t19?,20?,21?,22?,23-,26+,27-,28-,29+/m1/s1 |
| InChIKey | HTGCLINXXHBRKX-NZXCFPFASA-N |
| XLogP | 5.46 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|