C32H43N3O4 — CID 134141833
ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-formylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134141833) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-formylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-formylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134141833 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-formylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C[C@@H]4n1cc(COc2ccc(C=O)cc2)nn1 |
| InChI | InChI=1S/C32H43N3O4/c1-5-38-28(37)31(4)14-6-13-30(3)25(31)12-16-32-17-27(29(2,21-32)15-11-26(30)32)35-18-23(33-34-35)20-39-24-9-7-22(19-36)8-10-24/h7-10,18-19,25-27H,5-6,11-17,20-21H2,1-4H3/t25-,26-,27-,29-,30+,31+,32-/m0/s1 |
| InChIKey | AUWMXYKJRHDJNX-OQGDWMRESA-N |
| XLogP | 6.58 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|