C27H43NO4 — CID 172939193
ethyl (4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(3-methyloxetan-3-yl)methoxyimino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 172939193) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is ethyl (4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(3-methyloxetan-3-yl)methoxyimino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(3-methyloxetan-3-yl)methoxyimino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 172939193 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | ethyl (4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(3-methyloxetan-3-yl)methoxyimino]tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)CC3(CC[C@@H]21)C/C4=N\OCC1(C)COC1 |
| InChI | InChI=1S/C27H43NO4/c1-6-31-22(29)26(5)11-7-10-25(4)19(26)9-13-27-14-21(24(3,15-27)12-8-20(25)27)28-32-18-23(2)16-30-17-23/h19-20H,6-18H2,1-5H3/b28-21+/t19-,20-,24-,25+,26+,27?/m0/s1 |
| InChIKey | MKKNODUCOLIUJT-MOYICIFBSA-N |
| XLogP | 5.76 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|