C23H39NO2S — CID 71190192
(1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-N,N,5,9-tetramethyl-13-(methylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 71190192) has the molecular formula C23H39NO2S and a molecular weight of 393.64 g/mol. Its IUPAC name is (1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-N,N,5,9-tetramethyl-13-(methylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-N,N,5,9-tetramethyl-13-(methylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 71190192 |
| Molecular Formula | C23H39NO2S |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-N,N,5,9-tetramethyl-13-(methylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | CSC[C@H]1[C@H]2CC[C@@]3(CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)N(C)C)[C@@H]3C2)[C@@H]1O |
| InChI | InChI=1S/C23H39NO2S/c1-21-9-6-10-22(2,20(26)24(3)4)17(21)8-12-23-11-7-15(13-18(21)23)16(14-27-5)19(23)25/h15-19,25H,6-14H2,1-5H3/t15-,16-,17-,18-,19+,21+,22+,23-/m0/s1 |
| InChIKey | CUMQHJSYVXNYBP-JEYDOBMXSA-N |
| XLogP | 4.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |