C22H30O6S — CID 10598330
[(6S,9Z)-13-(methoxymethoxy)-9,13-dimethyl-8-oxo-6-prop-1-en-2-ylcyclotetradec-9-en-2,11-diyn-1-yl] methanesulfonate (PubChem CID 10598330) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is [(6S,9Z)-13-(methoxymethoxy)-9,13-dimethyl-8-oxo-6-prop-1-en-2-ylcyclotetradec-9-en-2,11-diyn-1-yl] methanesulfonate.
| Compound Name | [(6S,9Z)-13-(methoxymethoxy)-9,13-dimethyl-8-oxo-6-prop-1-en-2-ylcyclotetradec-9-en-2,11-diyn-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 10598330 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [(6S,9Z)-13-(methoxymethoxy)-9,13-dimethyl-8-oxo-6-prop-1-en-2-ylcyclotetradec-9-en-2,11-diyn-1-yl] methanesulfonate |
| SMILES | C=C(C)[C@H]1CCC#CC(OS(C)(=O)=O)CC(C)(OCOC)C#C/C=C(/C)C(=O)C1 |
| InChI | InChI=1S/C22H30O6S/c1-17(2)19-11-7-8-12-20(28-29(6,24)25)15-22(4,27-16-26-5)13-9-10-18(3)21(23)14-19/h10,19-20H,1,7,11,14-16H2,2-6H3/b18-10-/t19-,20?,22?/m0/s1 |
| InChIKey | INQCADRGNFNWHO-YEYKEHGHSA-N |
| XLogP | 3.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|