C37H48O4Si — CID 10650953
(2Z,13S)-8-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6-dimethyl-13-prop-1-en-2-ylcyclotetradec-2-en-4,9-diyn-1-ol (PubChem CID 10650953) has the molecular formula C37H48O4Si and a molecular weight of 584.87 g/mol. Its IUPAC name is (2Z,13S)-8-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6-dimethyl-13-prop-1-en-2-ylcyclotetradec-2-en-4,9-diyn-1-ol.
| Compound Name | (2Z,13S)-8-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6-dimethyl-13-prop-1-en-2-ylcyclotetradec-2-en-4,9-diyn-1-ol |
|---|---|
| PubChem CID | 10650953 |
| Molecular Formula | C37H48O4Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (2Z,13S)-8-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6-dimethyl-13-prop-1-en-2-ylcyclotetradec-2-en-4,9-diyn-1-ol |
| SMILES | C=C(C)[C@H]1CCC#CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(C)(OCOC)C#C/C=C(/C)C(O)C1 |
| InChI | InChI=1S/C37H48O4Si/c1-29(2)31-19-15-16-20-32(27-37(7,40-28-39-8)25-17-18-30(3)35(38)26-31)41-42(36(4,5)6,33-21-11-9-12-22-33)34-23-13-10-14-24-34/h9-14,18,21-24,31-32,35,38H,1,15,19,26-28H2,2-8H3/b30-18-/t31-,32?,35?,37?/m0/s1 |
| InChIKey | IAHLJUZFXSESEB-GRSGLYNBSA-N |
| XLogP | 6.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|