C42H50O11Si — CID 10908843
[(1R,3S,4R,6R)-3-benzoyloxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4,6-tris(methoxymethoxy)cyclohexyl] benzoate (PubChem CID 10908843) has the molecular formula C42H50O11Si and a molecular weight of 758.94 g/mol. Its IUPAC name is [(1R,3S,4R,6R)-3-benzoyloxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4,6-tris(methoxymethoxy)cyclohexyl] benzoate.
| Compound Name | [(1R,3S,4R,6R)-3-benzoyloxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4,6-tris(methoxymethoxy)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 10908843 |
| Molecular Formula | C42H50O11Si |
| Molecular Weight | 758.94 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | [(1R,3S,4R,6R)-3-benzoyloxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4,6-tris(methoxymethoxy)cyclohexyl] benzoate |
| SMILES | COCOC1C(OC(=O)c2ccccc2)[C@@H](OCOC)C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OCOC)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H50O11Si/c1-42(2,3)54(32-23-15-9-16-24-32,33-25-17-10-18-26-33)53-39-35(49-28-46-5)37(51-40(43)30-19-11-7-12-20-30)34(48-27-45-4)38(36(39)50-29-47-6)52-41(44)31-21-13-8-14-22-31/h7-26,34-39H,27-29H2,1-6H3/t34?,35-,36-,37+,38?,39?/m1/s1 |
| InChIKey | ACBZVMLDYMCKAL-LOKDTKEHSA-N |
| XLogP | 5.36 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|