C17H21NO7 — CID 10904264
[(3aR,4R,5S,6S)-5,6-bis(methoxymethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] benzoate (PubChem CID 10904264) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(3aR,4R,5S,6S)-5,6-bis(methoxymethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] benzoate.
| Compound Name | [(3aR,4R,5S,6S)-5,6-bis(methoxymethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] benzoate |
|---|---|
| PubChem CID | 10904264 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [(3aR,4R,5S,6S)-5,6-bis(methoxymethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] benzoate |
| SMILES | COCO[C@H]1[C@H](OC(=O)c2ccccc2)[C@H]2CON=C2[C@@H]1OCOC |
| InChI | InChI=1S/C17H21NO7/c1-20-9-22-15-13-12(8-24-18-13)14(16(15)23-10-21-2)25-17(19)11-6-4-3-5-7-11/h3-7,12,14-16H,8-10H2,1-2H3/t12-,14+,15-,16-/m0/s1 |
| InChIKey | AQBFAZROVCPHEC-UKMLZYKCSA-N |
| XLogP | 1.21 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|