C21H30O7 — CID 22319894
[4,5-bis(methoxymethoxy)-6-oxocyclodecyl] benzoate (PubChem CID 22319894) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [4,5-bis(methoxymethoxy)-6-oxocyclodecyl] benzoate.
| Compound Name | [4,5-bis(methoxymethoxy)-6-oxocyclodecyl] benzoate |
|---|---|
| PubChem CID | 22319894 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [4,5-bis(methoxymethoxy)-6-oxocyclodecyl] benzoate |
| SMILES | COCOC1CCC(OC(=O)c2ccccc2)CCCCC(=O)C1OCOC |
| InChI | InChI=1S/C21H30O7/c1-24-14-26-19-13-12-17(28-21(23)16-8-4-3-5-9-16)10-6-7-11-18(22)20(19)27-15-25-2/h3-5,8-9,17,19-20H,6-7,10-15H2,1-2H3 |
| InChIKey | OKSATBTYSQCNSV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|