C22H30O8 — CID 22319876
[(4Z)-7,8-bis(methoxymethoxy)-6-oxocyclodec-4-en-1-yl] 4-methoxybenzoate (PubChem CID 22319876) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [(4Z)-7,8-bis(methoxymethoxy)-6-oxocyclodec-4-en-1-yl] 4-methoxybenzoate.
| Compound Name | [(4Z)-7,8-bis(methoxymethoxy)-6-oxocyclodec-4-en-1-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 22319876 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(4Z)-7,8-bis(methoxymethoxy)-6-oxocyclodec-4-en-1-yl] 4-methoxybenzoate |
| SMILES | COCOC1CCC(OC(=O)c2ccc(OC)cc2)CC/C=C\C(=O)C1OCOC |
| InChI | InChI=1S/C22H30O8/c1-25-14-28-20-13-12-18(6-4-5-7-19(23)21(20)29-15-26-2)30-22(24)16-8-10-17(27-3)11-9-16/h5,7-11,18,20-21H,4,6,12-15H2,1-3H3/b7-5- |
| InChIKey | ZGWJSXLMWNXNTM-ALCCZGGFSA-N |
| XLogP | 2.90 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|