C22H26O4 — CID 158315244
(4-methylcyclohexyl) 4-[(4-methylphenoxy)methoxy]benzoate (PubChem CID 158315244) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (4-methylcyclohexyl) 4-[(4-methylphenoxy)methoxy]benzoate.
| Compound Name | (4-methylcyclohexyl) 4-[(4-methylphenoxy)methoxy]benzoate |
|---|---|
| PubChem CID | 158315244 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (4-methylcyclohexyl) 4-[(4-methylphenoxy)methoxy]benzoate |
| SMILES | Cc1ccc(OCOc2ccc(C(=O)OC3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H26O4/c1-16-3-9-19(10-4-16)24-15-25-20-13-7-18(8-14-20)22(23)26-21-11-5-17(2)6-12-21/h3-4,7-10,13-14,17,21H,5-6,11-12,15H2,1-2H3 |
| InChIKey | FDMLRINAYSDVDF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|