C19H26O7 — CID 91065711
(5,6-dihydroxy-4-oxocyclodecyl) 2-(methoxymethoxy)benzoate (PubChem CID 91065711) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is (5,6-dihydroxy-4-oxocyclodecyl) 2-(methoxymethoxy)benzoate.
| Compound Name | (5,6-dihydroxy-4-oxocyclodecyl) 2-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 91065711 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (5,6-dihydroxy-4-oxocyclodecyl) 2-(methoxymethoxy)benzoate |
| SMILES | COCOc1ccccc1C(=O)OC1CCCCC(O)C(O)C(=O)CC1 |
| InChI | InChI=1S/C19H26O7/c1-24-12-25-17-9-5-3-7-14(17)19(23)26-13-6-2-4-8-15(20)18(22)16(21)11-10-13/h3,5,7,9,13,15,18,20,22H,2,4,6,8,10-12H2,1H3 |
| InChIKey | MGWUTVAMOSIOHF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|