C35H36O7Si — CID 171122516
[(2S,3S,4R,5R)-4-benzoyloxy-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 171122516) has the molecular formula C35H36O7Si and a molecular weight of 596.75 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-benzoyloxy-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R,5R)-4-benzoyloxy-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 171122516 |
| Molecular Formula | C35H36O7Si |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [(2S,3S,4R,5R)-4-benzoyloxy-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(C)(C)[Si](O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](O)O[C@H]1COC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H36O7Si/c1-35(2,3)43(27-20-12-6-13-21-27,28-22-14-7-15-23-28)42-30-29(24-39-32(36)25-16-8-4-9-17-25)40-34(38)31(30)41-33(37)26-18-10-5-11-19-26/h4-23,29-31,34,38H,24H2,1-3H3/t29-,30-,31+,34+/m0/s1 |
| InChIKey | RMXWNRRTKHIIBW-JIAKNCRUSA-N |
| XLogP | 4.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|