C21H38O8Si — CID 146166965
6-[tert-butyl(dimethyl)silyl]oxy-9,11-bis(methoxymethoxy)-3,3-dimethyl-2,4-dioxatricyclo[6.2.1.01,5]undecan-7-one (PubChem CID 146166965) has the molecular formula C21H38O8Si and a molecular weight of 446.61 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-9,11-bis(methoxymethoxy)-3,3-dimethyl-2,4-dioxatricyclo[6.2.1.01,5]undecan-7-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-9,11-bis(methoxymethoxy)-3,3-dimethyl-2,4-dioxatricyclo[6.2.1.01,5]undecan-7-one |
|---|---|
| PubChem CID | 146166965 |
| Molecular Formula | C21H38O8Si |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-9,11-bis(methoxymethoxy)-3,3-dimethyl-2,4-dioxatricyclo[6.2.1.01,5]undecan-7-one |
| SMILES | COCOC1CC23OC(C)(C)OC2C(O[Si](C)(C)C(C)(C)C)C(=O)C1C3OCOC |
| InChI | InChI=1S/C21H38O8Si/c1-19(2,3)30(8,9)28-16-15(22)14-13(25-11-23-6)10-21(17(14)26-12-24-7)18(16)27-20(4,5)29-21/h13-14,16-18H,10-12H2,1-9H3 |
| InChIKey | LXZLDDNNBMUIIL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|