C36H54O5Si2 — CID 117070550
(3aR,5S,5aS,7S,8aS,8bS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-2,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-as-indacen-3-one (PubChem CID 117070550) has the molecular formula C36H54O5Si2 and a molecular weight of 623.00 g/mol. Its IUPAC name is (3aR,5S,5aS,7S,8aS,8bS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-2,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-as-indacen-3-one.
| Compound Name | (3aR,5S,5aS,7S,8aS,8bS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-2,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-as-indacen-3-one |
|---|---|
| PubChem CID | 117070550 |
| Molecular Formula | C36H54O5Si2 |
| Molecular Weight | 623.00 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | (3aR,5S,5aS,7S,8aS,8bS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-2,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-as-indacen-3-one |
| SMILES | COCO[C@H]1C[C@H]2C(=O)C(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C36H54O5Si2/c1-35(2,3)42(8,9)40-25-20-28-29-22-33(34(37)31(29)23-32(30(28)21-25)39-24-38-7)41-43(36(4,5)6,26-16-12-10-13-17-26)27-18-14-11-15-19-27/h10-19,25,28-33H,20-24H2,1-9H3/t25-,28-,29-,30-,31+,32-,33?/m0/s1 |
| InChIKey | XVJSVRZCAATWNE-BMJHTZICSA-N |
| XLogP | 6.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.00 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|