C22H42O6Si — CID 10502775
tert-butyl-[[(1R,2R,3S,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]oxy]-dimethylsilane (PubChem CID 10502775) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,3S,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,3S,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10502775 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | tert-butyl-[[(1R,2R,3S,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]oxy]-dimethylsilane |
| SMILES | COC(C)(C)[C@@]12C[C@H]3OC(C)(C)O[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C22H42O6Si/c1-18(2,3)29(11,12)27-16-15-14(24-20(6,7)25-15)13-22(19(4,5)23-10)17(16)26-21(8,9)28-22/h14-17H,13H2,1-12H3/t14-,15-,16-,17+,22-/m1/s1 |
| InChIKey | YICIIMOPVGKDBQ-GQTOQBHESA-N |
| XLogP | 4.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|