C18H34O6Si — CID 59053156
(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-bis(hydroxymethyl)-2-(methoxymethoxy)-4-methylbicyclo[3.2.0]heptan-6-one (PubChem CID 59053156) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-bis(hydroxymethyl)-2-(methoxymethoxy)-4-methylbicyclo[3.2.0]heptan-6-one.
| Compound Name | (1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-bis(hydroxymethyl)-2-(methoxymethoxy)-4-methylbicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 59053156 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-bis(hydroxymethyl)-2-(methoxymethoxy)-4-methylbicyclo[3.2.0]heptan-6-one |
| SMILES | COCO[C@H]1C[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H]2C(=O)C(CO)(CO)[C@@H]12 |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,3)25(6,7)24-17(4)8-12(23-11-22-5)13-14(17)15(21)18(13,9-19)10-20/h12-14,19-20H,8-11H2,1-7H3/t12-,13-,14+,17-/m0/s1 |
| InChIKey | PQEPWBGXORMMJA-ZJOBFFGXSA-N |
| XLogP | 1.95 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|