C18H34O4Si — CID 10641082
(1S,3R,3aR,6R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-3-methyl-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid (PubChem CID 10641082) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (1S,3R,3aR,6R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-3-methyl-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid.
| Compound Name | (1S,3R,3aR,6R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-3-methyl-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid |
|---|---|
| PubChem CID | 10641082 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (1S,3R,3aR,6R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxyethyl)-3-methyl-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylic acid |
| SMILES | CC(O)[C@@H]1CC[C@@H]2[C@H]1[C@@H](C(=O)O)C[C@@]2(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-11(19)12-8-9-14-15(12)13(16(20)21)10-18(14,5)22-23(6,7)17(2,3)4/h11-15,19H,8-10H2,1-7H3,(H,20,21)/t11?,12-,13-,14+,15+,18+/m0/s1 |
| InChIKey | HXVXLQCBHHGXMY-LLHCDRKFSA-N |
| XLogP | 3.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|