C13H24O5Si — CID 10517488
(2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxooxolane-3-carboxylic acid (PubChem CID 10517488) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxooxolane-3-carboxylic acid.
| Compound Name | (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 10517488 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxooxolane-3-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C13H24O5Si/c1-8(18-19(5,6)13(2,3)4)11-9(12(15)16)7-10(14)17-11/h8-9,11H,7H2,1-6H3,(H,15,16)/t8-,9-,11+/m1/s1 |
| InChIKey | BOJYEWAZANMXID-KKZNHRDASA-N |
| XLogP | 2.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|