C23H42O5Si — CID 135022294
[(1aR,4R,4aS,7S,7aS,7bR)-4-hydroxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate (PubChem CID 135022294) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is [(1aR,4R,4aS,7S,7aS,7bR)-4-hydroxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate.
| Compound Name | [(1aR,4R,4aS,7S,7aS,7bR)-4-hydroxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 135022294 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(1aR,4R,4aS,7S,7aS,7bR)-4-hydroxy-4,7-dimethyl-1a-propan-2-yl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| SMILES | CC(C)[C@]12CC(OC(=O)CO[Si](C)(C)C(C)(C)C)[C@](C)(O)[C@H]3CC[C@H](C)[C@@H]3[C@H]1O2 |
| InChI | InChI=1S/C23H42O5Si/c1-14(2)23-12-17(27-18(24)13-26-29(8,9)21(4,5)6)22(7,25)16-11-10-15(3)19(16)20(23)28-23/h14-17,19-20,25H,10-13H2,1-9H3/t15-,16-,17?,19-,20+,22+,23+/m0/s1 |
| InChIKey | ANEQAMKWBGHDAJ-CIBCUYGESA-N |
| XLogP | 4.53 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|