C15H30O10 — CID 25170089
(1R,2R,3S,4S,5R)-1-(hydroxymethyl)-2,3,4,5-tetrakis(methoxymethoxy)cyclohexan-1-ol (PubChem CID 25170089) has the molecular formula C15H30O10 and a molecular weight of 370.40 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R)-1-(hydroxymethyl)-2,3,4,5-tetrakis(methoxymethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3S,4S,5R)-1-(hydroxymethyl)-2,3,4,5-tetrakis(methoxymethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 25170089 |
| Molecular Formula | C15H30O10 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (1R,2R,3S,4S,5R)-1-(hydroxymethyl)-2,3,4,5-tetrakis(methoxymethoxy)cyclohexan-1-ol |
| SMILES | COCO[C@@H]1[C@H](OCOC)[C@@H](OCOC)[C@](O)(CO)C[C@H]1OCOC |
| InChI | InChI=1S/C15H30O10/c1-18-7-22-11-5-15(17,6-16)14(25-10-21-4)13(24-9-20-3)12(11)23-8-19-2/h11-14,16-17H,5-10H2,1-4H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | AKTKGCPJMNWQOR-GZBLMMOJSA-N |
| XLogP | -0.93 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|