C27H36O5 — CID 11178184
[(1S,2R,3R,4R,6S)-4-(methoxymethoxy)-2,3-dimethyl-6-phenylmethoxy-3-(phenylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol (PubChem CID 11178184) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(1S,2R,3R,4R,6S)-4-(methoxymethoxy)-2,3-dimethyl-6-phenylmethoxy-3-(phenylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol.
| Compound Name | [(1S,2R,3R,4R,6S)-4-(methoxymethoxy)-2,3-dimethyl-6-phenylmethoxy-3-(phenylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol |
|---|---|
| PubChem CID | 11178184 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [(1S,2R,3R,4R,6S)-4-(methoxymethoxy)-2,3-dimethyl-6-phenylmethoxy-3-(phenylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol |
| SMILES | COCO[C@@]12C[C@H](OCc3ccccc3)[C@@H](C1)[C@@](C)(CO)[C@]2(C)COCc1ccccc1 |
| InChI | InChI=1S/C27H36O5/c1-25(18-28)23-14-27(32-20-29-3,15-24(23)31-17-22-12-8-5-9-13-22)26(25,2)19-30-16-21-10-6-4-7-11-21/h4-13,23-24,28H,14-20H2,1-3H3/t23-,24+,25-,26+,27-/m1/s1 |
| InChIKey | HVYDDUARKXECGG-JGWHWLOXSA-N |
| XLogP | 4.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|