C29H38O4 — CID 11453733
(1R,2R,3R,4S,5S)-1-(methoxymethoxy)-2,3-dimethyl-5-phenylmethoxy-2-(phenylmethoxymethyl)-3-[(E)-prop-1-enyl]bicyclo[2.2.1]heptane (PubChem CID 11453733) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S)-1-(methoxymethoxy)-2,3-dimethyl-5-phenylmethoxy-2-(phenylmethoxymethyl)-3-[(E)-prop-1-enyl]bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,3R,4S,5S)-1-(methoxymethoxy)-2,3-dimethyl-5-phenylmethoxy-2-(phenylmethoxymethyl)-3-[(E)-prop-1-enyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11453733 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (1R,2R,3R,4S,5S)-1-(methoxymethoxy)-2,3-dimethyl-5-phenylmethoxy-2-(phenylmethoxymethyl)-3-[(E)-prop-1-enyl]bicyclo[2.2.1]heptane |
| SMILES | C/C=C/[C@]1(C)[C@@H]2C[C@@](OCOC)(C[C@@H]2OCc2ccccc2)[C@@]1(C)COCc1ccccc1 |
| InChI | InChI=1S/C29H38O4/c1-5-16-27(2)25-17-29(33-22-30-4,18-26(25)32-20-24-14-10-7-11-15-24)28(27,3)21-31-19-23-12-8-6-9-13-23/h5-16,25-26H,17-22H2,1-4H3/b16-5+/t25-,26+,27-,28+,29-/m1/s1 |
| InChIKey | ZJNNHCBUEZTIHF-QUAIHJGESA-N |
| XLogP | 6.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|