C22H30O2 — CID 11077909
(1S,2R,4R,7S,8R)-5,7,8-trimethyl-8-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]bicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 11077909) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1S,2R,4R,7S,8R)-5,7,8-trimethyl-8-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]bicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | (1S,2R,4R,7S,8R)-5,7,8-trimethyl-8-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]bicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 11077909 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (1S,2R,4R,7S,8R)-5,7,8-trimethyl-8-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]bicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | C/C=C/[C@]1(O)C[C@@H]2C(C)=C[C@H]1[C@H](C)[C@@]2(C)COCc1ccccc1 |
| InChI | InChI=1S/C22H30O2/c1-5-11-22(23)13-20-16(2)12-19(22)17(3)21(20,4)15-24-14-18-9-7-6-8-10-18/h5-12,17,19-20,23H,13-15H2,1-4H3/b11-5+/t17-,19-,20+,21+,22-/m0/s1 |
| InChIKey | SAPPLADIERXPSB-ALFIRRLSSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|