C23H34O4 — CID 11632192
(3aR,4S,5S,6R,6aS,10aS)-2,2,5,6-tetramethyl-6-(phenylmethoxymethyl)-3a,4,5,6a,7,8,9,10-octahydronaphtho[1,8a-d][1,3]dioxol-4-ol (PubChem CID 11632192) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3aR,4S,5S,6R,6aS,10aS)-2,2,5,6-tetramethyl-6-(phenylmethoxymethyl)-3a,4,5,6a,7,8,9,10-octahydronaphtho[1,8a-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4S,5S,6R,6aS,10aS)-2,2,5,6-tetramethyl-6-(phenylmethoxymethyl)-3a,4,5,6a,7,8,9,10-octahydronaphtho[1,8a-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11632192 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3aR,4S,5S,6R,6aS,10aS)-2,2,5,6-tetramethyl-6-(phenylmethoxymethyl)-3a,4,5,6a,7,8,9,10-octahydronaphtho[1,8a-d][1,3]dioxol-4-ol |
| SMILES | C[C@@H]1[C@H](O)[C@H]2OC(C)(C)O[C@]23CCCC[C@H]3[C@]1(C)COCc1ccccc1 |
| InChI | InChI=1S/C23H34O4/c1-16-19(24)20-23(27-21(2,3)26-20)13-9-8-12-18(23)22(16,4)15-25-14-17-10-6-5-7-11-17/h5-7,10-11,16,18-20,24H,8-9,12-15H2,1-4H3/t16-,18+,19+,20-,22-,23+/m1/s1 |
| InChIKey | DYIPPVJKLOAPLG-RPGNBKINSA-N |
| XLogP | 4.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |