C17H22O4 — CID 59680938
(1R,4S,5S,6S)-8,8-dimethyl-2-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol (PubChem CID 59680938) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1R,4S,5S,6S)-8,8-dimethyl-2-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol.
| Compound Name | (1R,4S,5S,6S)-8,8-dimethyl-2-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol |
|---|---|
| PubChem CID | 59680938 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1R,4S,5S,6S)-8,8-dimethyl-2-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O)[C@H]3CC3(COCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H22O4/c1-16(2)20-14-13(18)12-8-17(12,15(14)21-16)10-19-9-11-6-4-3-5-7-11/h3-7,12-15,18H,8-10H2,1-2H3/t12-,13+,14+,15+,17?/m1/s1 |
| InChIKey | JBKUESGTXDZTBE-GWTPXXFDSA-N |
| XLogP | 2.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |