C21H24O2 — CID 101105537
[(1R,4S)-1-methyl-4-phenylmethoxycyclopent-2-en-1-yl]methoxymethylbenzene (PubChem CID 101105537) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(1R,4S)-1-methyl-4-phenylmethoxycyclopent-2-en-1-yl]methoxymethylbenzene.
| Compound Name | [(1R,4S)-1-methyl-4-phenylmethoxycyclopent-2-en-1-yl]methoxymethylbenzene |
|---|---|
| PubChem CID | 101105537 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(1R,4S)-1-methyl-4-phenylmethoxycyclopent-2-en-1-yl]methoxymethylbenzene |
| SMILES | C[C@]1(COCc2ccccc2)C=C[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H24O2/c1-21(17-22-15-18-8-4-2-5-9-18)13-12-20(14-21)23-16-19-10-6-3-7-11-19/h2-13,20H,14-17H2,1H3/t20-,21+/m1/s1 |
| InChIKey | QNXJKZVAFJTFIN-RTWAWAEBSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|