C14H18O5 — CID 56631557
1-(phenylmethoxymethyl)cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 56631557) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-(phenylmethoxymethyl)cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | 1-(phenylmethoxymethyl)cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 56631557 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-(phenylmethoxymethyl)cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | OC1C=CC(O)(COCc2ccccc2)C(O)C1O |
| InChI | InChI=1S/C14H18O5/c15-11-6-7-14(18,13(17)12(11)16)9-19-8-10-4-2-1-3-5-10/h1-7,11-13,15-18H,8-9H2 |
| InChIKey | MLDCCUCSWJIRCM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|