C24H31BO4 — CID 132577301
2-[(1R,2S,3R)-2,3-bis(phenylmethoxy)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 132577301) has the molecular formula C24H31BO4 and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-2,3-bis(phenylmethoxy)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1R,2S,3R)-2,3-bis(phenylmethoxy)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132577301 |
| Molecular Formula | C24H31BO4 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[(1R,2S,3R)-2,3-bis(phenylmethoxy)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB([C@@H]2C[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H31BO4/c1-23(2)24(3,4)29-25(28-23)20-15-21(26-16-18-11-7-5-8-12-18)22(20)27-17-19-13-9-6-10-14-19/h5-14,20-22H,15-17H2,1-4H3/t20-,21-,22+/m1/s1 |
| InChIKey | MRVBWBVBBIOCJO-VSKRKVRLSA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|