C20H29BO3 — CID 101421964
2-[(4S)-3,3-dimethyl-4-phenylmethoxycyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101421964) has the molecular formula C20H29BO3 and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-[(4S)-3,3-dimethyl-4-phenylmethoxycyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(4S)-3,3-dimethyl-4-phenylmethoxycyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101421964 |
| Molecular Formula | C20H29BO3 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[(4S)-3,3-dimethyl-4-phenylmethoxycyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)C=C(B2OC(C)(C)C(C)(C)O2)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H29BO3/c1-18(2)13-16(21-23-19(3,4)20(5,6)24-21)12-17(18)22-14-15-10-8-7-9-11-15/h7-11,13,17H,12,14H2,1-6H3/t17-/m0/s1 |
| InChIKey | BZVDKNKMUKQCRJ-KRWDZBQOSA-N |
| XLogP | 4.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|