C26H33NO5 — CID 90833033
(3aR,5S,6R,6aR)-1-(2,2-dimethyl-1,3-dioxan-5-yl)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole (PubChem CID 90833033) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-1-(2,2-dimethyl-1,3-dioxan-5-yl)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (3aR,5S,6R,6aR)-1-(2,2-dimethyl-1,3-dioxan-5-yl)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 90833033 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (3aR,5S,6R,6aR)-1-(2,2-dimethyl-1,3-dioxan-5-yl)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
| SMILES | CC1(C)OCC(N2OC[C@@H]3C[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H]32)CO1 |
| InChI | InChI=1S/C26H33NO5/c1-26(2)30-17-22(18-31-26)27-24-21(16-32-27)13-23(28-14-19-9-5-3-6-10-19)25(24)29-15-20-11-7-4-8-12-20/h3-12,21-25H,13-18H2,1-2H3/t21-,23-,24+,25-/m0/s1 |
| InChIKey | HACAUJHWAIVJSF-CGBRIMPHSA-N |
| XLogP | 3.94 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |