C28H29NO5 — CID 90928185
benzyl (3aR,5R,6S,6aR)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate (PubChem CID 90928185) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is benzyl (3aR,5R,6S,6aR)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate.
| Compound Name | benzyl (3aR,5R,6S,6aR)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate |
|---|---|
| PubChem CID | 90928185 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | benzyl (3aR,5R,6S,6aR)-5,6-bis(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1OC[C@@H]2C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C28H29NO5/c30-28(33-19-23-14-8-3-9-15-23)29-26-24(20-34-29)16-25(31-17-21-10-4-1-5-11-21)27(26)32-18-22-12-6-2-7-13-22/h1-15,24-27H,16-20H2/t24-,25+,26+,27+/m0/s1 |
| InChIKey | AIRSLSCSDMDPMC-FICKONGGSA-N |
| XLogP | 5.13 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |