C21H22FNO5 — CID 77233913
benzyl 6-fluoro-4-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate (PubChem CID 77233913) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is benzyl 6-fluoro-4-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate.
| Compound Name | benzyl 6-fluoro-4-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate |
|---|---|
| PubChem CID | 77233913 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | benzyl 6-fluoro-4-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1OCC2C(O)C(OCc3ccccc3)C(F)C21 |
| InChI | InChI=1S/C21H22FNO5/c22-17-18-16(19(24)20(17)26-11-14-7-3-1-4-8-14)13-28-23(18)21(25)27-12-15-9-5-2-6-10-15/h1-10,16-20,24H,11-13H2 |
| InChIKey | ANLKKLGAAQZYAH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |