C28H30ClNO4 — CID 102526085
benzyl (2S,3R,4R)-2-(chloromethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate (PubChem CID 102526085) has the molecular formula C28H30ClNO4 and a molecular weight of 480.00 g/mol. Its IUPAC name is benzyl (2S,3R,4R)-2-(chloromethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R)-2-(chloromethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102526085 |
| Molecular Formula | C28H30ClNO4 |
| Molecular Weight | 480.00 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | benzyl (2S,3R,4R)-2-(chloromethyl)-3,4-bis(phenylmethoxy)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1CCl |
| InChI | InChI=1S/C28H30ClNO4/c29-18-25-27(33-20-23-12-6-2-7-13-23)26(32-19-22-10-4-1-5-11-22)16-17-30(25)28(31)34-21-24-14-8-3-9-15-24/h1-15,25-27H,16-21H2/t25-,26-,27-/m1/s1 |
| InChIKey | WLXGFPHVDSBGCK-ZONZVBGPSA-N |
| XLogP | 5.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|