C8H14O4 — CID 102213220
[(1R,2R,3S,5S)-3-(methoxymethoxy)-6-oxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 102213220) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-3-(methoxymethoxy)-6-oxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(1R,2R,3S,5S)-3-(methoxymethoxy)-6-oxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 102213220 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | [(1R,2R,3S,5S)-3-(methoxymethoxy)-6-oxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | COCO[C@H]1C[C@@H]2O[C@@H]2[C@@H]1CO |
| InChI | InChI=1S/C8H14O4/c1-10-4-11-6-2-7-8(12-7)5(6)3-9/h5-9H,2-4H2,1H3/t5-,6+,7+,8-/m1/s1 |
| InChIKey | JPYMHIHSCHAKNP-VGRMVHKJSA-N |
| XLogP | -0.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|