C5H8O2 — CID 88623033
[(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (PubChem CID 88623033) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
| Compound Name | [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
|---|---|
| PubChem CID | 88623033 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| SMILES | OC[C@H]1C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C5H8O2/c6-2-3-1-4-5(3)7-4/h3-6H,1-2H2/t3-,4+,5-/m1/s1 |
| InChIKey | YNWKMBDDZMTYAC-MROZADKFSA-N |
| XLogP | -0.23 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|