About [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol
[(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (PubChem CID 88623033) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
Molecular Properties
| Compound Name | [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| PubChem CID | 88623033 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| SMILES | OC[C@H]1C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C5H8O2/c6-2-3-1-4-5(3)7-4/h3-6H,1-2H2/t3-,4+,5-/m1/s1 |
| InChIKey | YNWKMBDDZMTYAC-MROZADKFSA-N |
| XLogP | -0.23 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The IUPAC name of [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (CID 88623033) is [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
What is the SMILES notation for [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The canonical SMILES for [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol is OC[C@H]1C[C@@H]2O[C@H]12.
What is the InChIKey of [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
The InChIKey is YNWKMBDDZMTYAC-MROZADKFSA-N. The full InChI is InChI=1S/C5H8O2/c6-2-3-1-4-5(3)7-4/h3-6H,1-2H2/t3-,4+,5-/m1/s1.
What are the key properties of [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol?
[(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol has a molecular weight of 100.12 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R,4S)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol is sourced from PubChem (CID 88623033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).