C10H18O6 — CID 11481710
[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 11481710) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 11481710 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | COCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CO |
| InChI | InChI=1S/C10H18O6/c1-10(2)15-8-7(13-5-12-3)6(4-11)14-9(8)16-10/h6-9,11H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | KDDOVRHGSLDVPU-BZNPZCIMSA-N |
| XLogP | -0.16 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|