C25H40O6 — CID 117070838
(2S,6S,7R)-7-(methoxymethoxy)-5,5,11,11-tetramethyl-6-(phenylmethoxymethoxy)bicyclo[6.2.1]undecane-1,2-diol (PubChem CID 117070838) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is (2S,6S,7R)-7-(methoxymethoxy)-5,5,11,11-tetramethyl-6-(phenylmethoxymethoxy)bicyclo[6.2.1]undecane-1,2-diol.
| Compound Name | (2S,6S,7R)-7-(methoxymethoxy)-5,5,11,11-tetramethyl-6-(phenylmethoxymethoxy)bicyclo[6.2.1]undecane-1,2-diol |
|---|---|
| PubChem CID | 117070838 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2S,6S,7R)-7-(methoxymethoxy)-5,5,11,11-tetramethyl-6-(phenylmethoxymethoxy)bicyclo[6.2.1]undecane-1,2-diol |
| SMILES | COCO[C@@H]1C2CCC(O)([C@@H](O)CCC(C)(C)[C@@H]1OCOCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C25H40O6/c1-23(2)13-12-20(26)25(27)14-11-19(24(25,3)4)21(30-16-28-5)22(23)31-17-29-15-18-9-7-6-8-10-18/h6-10,19-22,26-27H,11-17H2,1-5H3/t19?,20-,21+,22+,25?/m0/s1 |
| InChIKey | HEMXPOVWQSAUSE-LXXURDHQSA-N |
| XLogP | 3.88 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|