C19H31NO6 — CID 10429185
(2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-(4-phenylmethoxybutyl)pyrrolidine (PubChem CID 10429185) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-(4-phenylmethoxybutyl)pyrrolidine.
| Compound Name | (2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-(4-phenylmethoxybutyl)pyrrolidine |
|---|---|
| PubChem CID | 10429185 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-(4-phenylmethoxybutyl)pyrrolidine |
| SMILES | COCO[C@@H]1[C@@H](OCOC)CN(O)[C@H]1CCCCOCc1ccccc1 |
| InChI | InChI=1S/C19H31NO6/c1-22-14-25-18-12-20(21)17(19(18)26-15-23-2)10-6-7-11-24-13-16-8-4-3-5-9-16/h3-5,8-9,17-19,21H,6-7,10-15H2,1-2H3/t17-,18-,19-/m0/s1 |
| InChIKey | CCEYJKMRACWJST-FHWLQOOXSA-N |
| XLogP | 2.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|