C24H31NO5 — CID 15085435
(1S,2R,8R,8aR)-1,2-bis(phenylmethoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 15085435) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (1S,2R,8R,8aR)-1,2-bis(phenylmethoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | (1S,2R,8R,8aR)-1,2-bis(phenylmethoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 15085435 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (1S,2R,8R,8aR)-1,2-bis(phenylmethoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | O[C@@H]1CCCN2C[C@@H](OCOCc3ccccc3)[C@@H](OCOCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C24H31NO5/c26-21-12-7-13-25-14-22(29-17-27-15-19-8-3-1-4-9-19)24(23(21)25)30-18-28-16-20-10-5-2-6-11-20/h1-6,8-11,21-24,26H,7,12-18H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | JWMYMHIKSOTSBH-MOUTVQLLSA-N |
| XLogP | 2.94 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|