C17H25NO4 — CID 59100041
(1S,7S,8R,8aR)-7-(2-phenylmethoxyethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol (PubChem CID 59100041) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (1S,7S,8R,8aR)-7-(2-phenylmethoxyethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol.
| Compound Name | (1S,7S,8R,8aR)-7-(2-phenylmethoxyethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
|---|---|
| PubChem CID | 59100041 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (1S,7S,8R,8aR)-7-(2-phenylmethoxyethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
| SMILES | OC1CN2CC[C@@H](CCOCc3ccccc3)[C@@H](O)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C17H25NO4/c19-14-10-18-8-6-13(16(20)15(18)17(14)21)7-9-22-11-12-4-2-1-3-5-12/h1-5,13-17,19-21H,6-11H2/t13-,14?,15+,16+,17+/m0/s1 |
| InChIKey | KERADRWGCPGYHR-KHGQFXJMSA-N |
| XLogP | 0.38 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|