C29H38O6 — CID 139713358
(5Z)-7-(methoxymethoxy)-2,2-dimethyl-4,8-bis(phenylmethoxy)-3-prop-2-enylcyclooct-5-ene-1,3-diol (PubChem CID 139713358) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (5Z)-7-(methoxymethoxy)-2,2-dimethyl-4,8-bis(phenylmethoxy)-3-prop-2-enylcyclooct-5-ene-1,3-diol.
| Compound Name | (5Z)-7-(methoxymethoxy)-2,2-dimethyl-4,8-bis(phenylmethoxy)-3-prop-2-enylcyclooct-5-ene-1,3-diol |
|---|---|
| PubChem CID | 139713358 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (5Z)-7-(methoxymethoxy)-2,2-dimethyl-4,8-bis(phenylmethoxy)-3-prop-2-enylcyclooct-5-ene-1,3-diol |
| SMILES | C=CCC1(O)C(OCc2ccccc2)/C=C\C(OCOC)C(OCc2ccccc2)C(O)C1(C)C |
| InChI | InChI=1S/C29H38O6/c1-5-18-29(31)25(33-19-22-12-8-6-9-13-22)17-16-24(35-21-32-4)26(27(30)28(29,2)3)34-20-23-14-10-7-11-15-23/h5-17,24-27,30-31H,1,18-21H2,2-4H3/b17-16- |
| InChIKey | MSODJMRBWHPPSA-MSUUIHNZSA-N |
| XLogP | 4.41 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|