C36H42O6 — CID 11731462
(1S,2S,3Z,5R,6S,7R,9S)-5-(methoxymethoxy)-11,11-dimethyl-9-phenyl-2,6-bis(phenylmethoxy)-1-prop-2-enyl-8,10-dioxabicyclo[5.3.1]undec-3-ene (PubChem CID 11731462) has the molecular formula C36H42O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is (1S,2S,3Z,5R,6S,7R,9S)-5-(methoxymethoxy)-11,11-dimethyl-9-phenyl-2,6-bis(phenylmethoxy)-1-prop-2-enyl-8,10-dioxabicyclo[5.3.1]undec-3-ene.
| Compound Name | (1S,2S,3Z,5R,6S,7R,9S)-5-(methoxymethoxy)-11,11-dimethyl-9-phenyl-2,6-bis(phenylmethoxy)-1-prop-2-enyl-8,10-dioxabicyclo[5.3.1]undec-3-ene |
|---|---|
| PubChem CID | 11731462 |
| Molecular Formula | C36H42O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | (1S,2S,3Z,5R,6S,7R,9S)-5-(methoxymethoxy)-11,11-dimethyl-9-phenyl-2,6-bis(phenylmethoxy)-1-prop-2-enyl-8,10-dioxabicyclo[5.3.1]undec-3-ene |
| SMILES | C=CC[C@@]12O[C@@H](c3ccccc3)O[C@@H]([C@@H](OCc3ccccc3)[C@H](OCOC)/C=C\[C@@H]1OCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C36H42O6/c1-5-23-36-31(38-24-27-15-9-6-10-16-27)22-21-30(40-26-37-4)32(39-25-28-17-11-7-12-18-28)33(35(36,2)3)41-34(42-36)29-19-13-8-14-20-29/h5-22,30-34H,1,23-26H2,2-4H3/b22-21-/t30-,31+,32+,33+,34+,36-/m1/s1 |
| InChIKey | CMLZHQSUONJWHC-PNARYOSDSA-N |
| XLogP | 7.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|