C32H38O6 — CID 46855657
(1S,5R,6R,8S)-9-(2,2-dimethylpropyl)-3-phenyl-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonane-7,9-diol (PubChem CID 46855657) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is (1S,5R,6R,8S)-9-(2,2-dimethylpropyl)-3-phenyl-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonane-7,9-diol.
| Compound Name | (1S,5R,6R,8S)-9-(2,2-dimethylpropyl)-3-phenyl-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonane-7,9-diol |
|---|---|
| PubChem CID | 46855657 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (1S,5R,6R,8S)-9-(2,2-dimethylpropyl)-3-phenyl-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonane-7,9-diol |
| SMILES | CC(C)(C)CC1(O)[C@@H]2OC(c3ccccc3)O[C@H]1[C@@H](OCc1ccccc1)C(O)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C32H38O6/c1-31(2,3)21-32(34)28-26(35-19-22-13-7-4-8-14-22)25(33)27(36-20-23-15-9-5-10-16-23)29(32)38-30(37-28)24-17-11-6-12-18-24/h4-18,25-30,33-34H,19-21H2,1-3H3/t25?,26-,27+,28-,29+,30?,32? |
| InChIKey | VYZJVOCZYUHWQC-JEYBRXJWSA-N |
| XLogP | 5.18 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |