C29H32O6 — CID 101067634
(4aR,6S,7R,8S,8aR)-6-ethyl-2-phenyl-7,8-bis(phenylmethoxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ol (PubChem CID 101067634) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aR)-6-ethyl-2-phenyl-7,8-bis(phenylmethoxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ol.
| Compound Name | (4aR,6S,7R,8S,8aR)-6-ethyl-2-phenyl-7,8-bis(phenylmethoxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ol |
|---|---|
| PubChem CID | 101067634 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (4aR,6S,7R,8S,8aR)-6-ethyl-2-phenyl-7,8-bis(phenylmethoxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-ol |
| SMILES | CC[C@]1(O)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O6/c1-2-29(30)27(32-19-22-14-8-4-9-15-22)26(31-18-21-12-6-3-7-13-21)25-24(35-29)20-33-28(34-25)23-16-10-5-11-17-23/h3-17,24-28,30H,2,18-20H2,1H3/t24-,25-,26+,27-,28?,29+/m1/s1 |
| InChIKey | XVVDMCKZRRZTFC-ICHYBAGLSA-N |
| XLogP | 4.77 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |