C26H31NO4 — CID 42624758
(1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylprop-2-en-1-amine (PubChem CID 42624758) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylprop-2-en-1-amine.
| Compound Name | (1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylprop-2-en-1-amine |
|---|---|
| PubChem CID | 42624758 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (1R)-1-[(3aS,5S,6R,6aS)-3a-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylprop-2-en-1-amine |
| SMILES | C=C[C@@H](NCc1ccccc1)[C@@H]1O[C@@]2(C=C)OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO4/c1-5-21(27-17-19-13-9-7-10-14-19)22-23(28-18-20-15-11-8-12-16-20)24-26(6-2,29-22)31-25(3,4)30-24/h5-16,21-24,27H,1-2,17-18H2,3-4H3/t21-,22+,23-,24+,26+/m1/s1 |
| InChIKey | WJHIEYGAGLDHEE-OXCVBPRPSA-N |
| XLogP | 4.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|